BackLesson 1.6: Carboxylic Acids, Esters, and Fats: Structure, Properties, and Reactions
Study Guide - Smart Notes
Tailored notes based on your materials, expanded with key definitions, examples, and context.
Carboxylic Acids
Definition and Structure
Carboxylic acids are a class of weak organic acids characterized by the presence of at least one carboxyl group (–COOH). The carboxyl group consists of a carbon atom double-bonded to an oxygen atom (carbonyl group) and single-bonded to a hydroxyl group (–OH).
Carboxyl group:
Carboxylic acids are weak acids because they partially dissociate in aqueous solution, releasing hydrogen ions ().
Common in foods (e.g., citric acid in citrus fruits, ascorbic acid in sour candies) and biological systems (e.g., sweat).
Naming Carboxylic Acids
Carboxylic acids are named systematically using IUPAC rules:
Identify the longest carbon chain containing the carboxyl group; include the carboxyl carbon in the chain.
Replace the -e ending of the parent alkane with -oic acid.
Number the chain so that the carboxyl group is at position 1.
For compounds with more than one carboxyl group, use the suffix -dioic acid or -tricarboxylic acid as appropriate.
Some common names are also accepted by IUPAC (e.g., formic acid for methanoic acid, acetic acid for ethanoic acid, benzoic acid).
Examples:
Methanoic acid (formic acid):
Ethanoic acid (acetic acid):
Propanoic acid:
Benzoic acid: Aromatic carboxylic acid ()
Citric acid: 2-hydroxypropane-1,2,3-tricarboxylic acid (contains three carboxyl groups)
Properties of Carboxylic Acids
Highly polar due to the presence of both carbonyl and hydroxyl groups.
Form strong hydrogen bonds with water and with each other.
Carboxylic acids with up to five carbon atoms are very soluble in water; solubility decreases with increasing hydrocarbon chain length.
Higher melting points than corresponding alkanes due to dipole-dipole interactions and hydrogen bonding.
React with bases to form ionic salts (e.g., sodium benzoate, used as a preservative).
Affect acid–base indicators (e.g., turn litmus paper red).
Table: Comparison of Melting Points of Carboxylic Acids and Alkanes
Number of Carbon Atoms | Number of –COOH Groups | Compound | Melting Point (°C) |
|---|---|---|---|
1 | 0 | Methane | -182 |
1 | 1 | Methanoic acid (formic acid) | 8 |
2 | 0 | Ethane | -183 |
2 | 1 | Ethanoic acid (acetic acid) | 17 |
2 | 2 | Ethanedioic acid (oxalic acid) | 189 |
4 | 0 | Butane | -138 |
4 | 1 | Butanoic acid | -8 |
4 | 2 | 2,3-dihydroxybutanedioic acid (tartaric acid) | 206 |
6 | 0 | Hexane | -95 |
6 | 1 | Hexanoic acid | 13 |
6 | 3 | 2-hydroxypropane-1,2,3-tricarboxylic acid (citric acid) | 153 |
Reactions Involving Carboxylic Acids
Oxidation: Carboxylic acids are formed by the controlled oxidation of aldehydes.
Acid-Base Reactions: React with bases to form salts and water.
Combustion: Like other organic molecules, carboxylic acids are flammable and combust to form and .
Example: Oxidation of Butan-1-ol to Butanoic Acid
Step 1: Butan-1-ol is oxidized to butanal (an aldehyde).
Step 2: Butanal is further oxidized to butanoic acid.
Esters
Definition and Structure
Esters are organic compounds derived from carboxylic acids and alcohols. They contain a functional group similar to the carboxyl group, but the hydrogen atom of the –COOH group is replaced by an alkyl group.
General structure:
Responsible for the aromas and flavors of many fruits and flowers.
Naming Esters
The name is derived from two parts:
The alkyl group from the alcohol (written first).
The acid part, with the -oic acid ending replaced by -oate.
Example: Pentyl butanoate (from pentan-1-ol and butanoic acid).
Formation (Esterification): Esters are formed by the condensation reaction of a carboxylic acid and an alcohol, producing an ester and water.
Properties of Esters
Less polar than carboxylic acids; do not form hydrogen bonds with each other.
Small esters are somewhat soluble in water; solubility decreases with increasing size.
Lower boiling points than carboxylic acids of similar molar mass.
Many esters are volatile and have distinctive odors (e.g., pineapple, cherry, apricot).
Reactions Involving Esters
Esterification: Formation of an ester from a carboxylic acid and an alcohol (see above).
Hydrolysis: The reverse of esterification; an ester reacts with water (often in the presence of acid or base) to yield a carboxylic acid and an alcohol.
In basic hydrolysis (saponification), the carboxylic acid is produced as its salt:
Fats, Oils, and Saponification
Fats and Oils (Triglycerides)
Fats and oils are large esters known as lipids. They are formed from the reaction of glycerol (a triol) with three long-chain carboxylic acids (fatty acids), producing a triglyceride.
Glycerol:
Fatty acid: Long-chain carboxylic acid (e.g., palmitic acid, oleic acid, linoleic acid, stearic acid).
Triglyceride: Ester formed from glycerol and three fatty acids.
Fats are usually solid at room temperature; oils are liquid. The physical state depends on the chain length and degree of unsaturation of the fatty acids.
Table: Common Fatty Acids
Name | Formula | Source |
|---|---|---|
Linoleic acid | CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH | Vegetable oils (e.g., sunflower seed oil, soya bean oil) |
Oleic acid | CH3(CH2)7CH=CH(CH2)7COOH | Most animal fats and vegetable oils (e.g., olive oil) |
Palmitic acid | CH3(CH2)14COOH | Lard, tallow, palm, and olive oils |
Stearic acid | CH3(CH2)16COOH | Most animal fats and vegetable oils |
Saponification (Soap Making)
Saponification is the process of hydrolyzing a triglyceride (fat or oil) with a strong base (e.g., sodium hydroxide) to produce glycerol and the sodium salt of the fatty acid (soap).
Example: Hydrolysis of palmitin (a triglyceride) yields sodium palmitate (soap) and glycerol.
Structure and Properties of Fats and Oils
Lipids are insoluble in water due to their long non-polar hydrocarbon chains.
The physical state (solid or liquid) depends on the degree of saturation:
Saturated fatty acids: No double bonds; pack tightly; higher melting points; solid at room temperature.
Unsaturated fatty acids (cis): One or more cis double bonds; kinks prevent tight packing; lower melting points; liquid at room temperature.
Unsaturated fatty acids (trans): Trans double bonds; straighter chains; pack more like saturated fats; higher melting points; often solid at room temperature.
Trans fats are produced industrially by hydrogenation of oils and are associated with health risks.
Summary of Key Concepts
A carboxyl group is a combination of a carbonyl group (C=O) and a hydroxyl group (O–H).
Carboxylic acids are named by replacing the -e ending of the alkane with -oic acid.
Carboxylic acids are formed by the controlled oxidation of aldehydes.
An ester's name is derived from the alcohol's alkyl group (first) and the carboxylic acid's alkyl group (second, with -oate ending).
Esterification is the formation of an ester from a carboxylic acid and an alcohol; hydrolysis is the reverse reaction.
Fats and oils are triglycerides—esters made from glycerol and three fatty acids.
Saponification is the process by which a triglyceride reacts with a strong base to form soap (the salt of a fatty acid) and glycerol.
Practice and Application
Draw and name carboxylic acids and esters from structural formulas.
Write equations for the oxidation of alcohols to carboxylic acids, esterification, and saponification reactions.
Compare physical properties (solubility, melting point) of carboxylic acids, esters, and related compounds.
Relate the structure of fatty acids to the physical properties of fats and oils.
Additional info: This summary includes expanded explanations of naming conventions, reaction mechanisms, and the relationship between structure and physical properties, as well as tables for melting points and fatty acids, to provide a comprehensive overview suitable for general chemistry students.