The two amino acids shown above are joined together by a peptide bond and form a molecule of which of the following in the process?

Which molecule acts as an enzyme during the formation of peptide bonds between amino acids?

In the dipeptide shown below, which answer choice correctly identifies the location of the peptide bond?\[\text{Glycine} - \ce{NH2-CH2-COOH} + \text{Alanine} - \ce{NH2-CH(CH3)-COOH}\]A segment of the resulting dipeptide is:\[\ce{NH2-CH2-CO-NH-CH(CH3)-COOH}\]Which bond is the peptide bond?

Which of the following best describes the function of a peptide bond in proteins?

Which of the following peptides is most likely to form a covalently bonded dimer?

The bonding of two amino acid molecules to form a larger molecule requires:

Amino acids joining together to make a peptide is a good example of a(n) ________ reaction.

A peptidase breaks down peptides into which of the following products?

Which of the following statements about peptide bonds is true?