Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2685views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2668views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines. c. 633views
Textbook Questiona. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1309views
Textbook QuestionProvide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring754views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 538views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 532views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 555views