Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.a. CH3(CH2)4CH2NH2796views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines.b. CH3CH2CH2NHCH(CH3)2742views
Textbook QuestionIdentify the following compounds as primary, secondary, or tertiary amines. c. 756views
Textbook Questiona. For the compound above, identify each nitrogen as either a primary, secondary, tertiary, quaternary, or aromatic amine.1369views
Textbook QuestionProvide compounds that fit the following descriptions:a. Two amines that are gases at room temperatureb. A heterocyclic aminec. A compound with an amine group on an aromatic ring831views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c 648views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):d. 635views
Textbook QuestionClassify each of the following amines as primary (1°), secondary (2°), or tertiary (3°):c. 668views